CAS 109230-72-0 is the registry number for 1-Nitro-4-(2,2,3,3-tetrafluoropropoxy)benzene, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
1-nitro-4-(2,2,3,3-tetrafluoropropoxy)benzene (CAS 109230-72-0) is a chemical compound with the molecular formula C9H7F4NO3 and a molecular weight of 253.15 g/mol. IUPAC name: 1-nitro-4-(2,2,3,3-tetrafluoropropoxy)benzene. InChIKey: JEPDRBCJTPBIMP-UHFFFAOYSA-N.
| Molecular formula | C9H7F4NO3 |
|---|---|
| Molecular weight | 253.15 g/mol |
| IUPAC name | 1-nitro-4-(2,2,3,3-tetrafluoropropoxy)benzene |
| InChIKey | JEPDRBCJTPBIMP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1[N+](=O)[O-])OCC(C(F)F)(F)F |
Computed by PubChem (NCBI)