Products 2755892-93-2

CAS 2755892-93-2 is the registry number for 2-(5-Fluoro-2-(trifluoromethoxy)pyridin-4-yl)propanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-[5-fluoro-2-(trifluoromethoxy)-4-pyridinyl]propanoic acid (CAS 2755892-93-2) is a chemical compound with the molecular formula C9H7F4NO3 and a molecular weight of 253.15 g/mol. IUPAC name: 2-[5-fluoro-2-(trifluoromethoxy)-4-pyridinyl]propanoic acid. InChIKey: DMXAYTSYZIVEEW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F4NO3
Molecular weight253.15 g/mol
IUPAC name2-[5-fluoro-2-(trifluoromethoxy)-4-pyridinyl]propanoic acid
InChIKeyDMXAYTSYZIVEEW-UHFFFAOYSA-N
SMILESCC(C1=CC(=NC=C1F)OC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)