CAS 28202-30-4 is the registry number for 2-Tetrafluoroethoxy-5-nitrotoluene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-methyl-4-nitro-1-(1,1,2,2-tetrafluoroethoxy)benzene (CAS 28202-30-4) is a chemical compound with the molecular formula C9H7F4NO3 and a molecular weight of 253.15 g/mol. IUPAC name: 2-methyl-4-nitro-1-(1,1,2,2-tetrafluoroethoxy)benzene. InChIKey: JHPMFMSCHNLTQM-UHFFFAOYSA-N.
| Molecular formula | C9H7F4NO3 |
|---|---|
| Molecular weight | 253.15 g/mol |
| IUPAC name | 2-methyl-4-nitro-1-(1,1,2,2-tetrafluoroethoxy)benzene |
| InChIKey | JHPMFMSCHNLTQM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)[N+](=O)[O-])OC(C(F)F)(F)F |
Computed by PubChem (NCBI)