Products 1092395-13-5

CAS 1092395-13-5 is the registry number for Ketoprofen Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2-cyanopropan-2-yl)benzoyl chloride (CAS 1092395-13-5) is a chemical compound with the molecular formula C11H10ClNO and a molecular weight of 207.65 g/mol. IUPAC name: 3-(2-cyanopropan-2-yl)benzoyl chloride. InChIKey: XJGOKLDKOUXTNS-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10ClNO
Molecular weight207.65 g/mol
IUPAC name3-(2-cyanopropan-2-yl)benzoyl chloride
InChIKeyXJGOKLDKOUXTNS-UHFFFAOYSA-N
SMILESCC(C)(C#N)C1=CC=CC(=C1)C(=O)Cl

Computed by PubChem (NCBI)