CAS 1092461-38-5 is the registry number for 3-Chloro-2-fluoro-6-(trifluoromethyl)aniline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg.
3-chloro-2-fluoro-6-(trifluoromethyl)aniline (CAS 1092461-38-5) is a chemical compound with the molecular formula C7H4ClF4N and a molecular weight of 213.56 g/mol. IUPAC name: 3-chloro-2-fluoro-6-(trifluoromethyl)aniline. InChIKey: ZHDSWEWAMCTWAZ-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF4N |
|---|---|
| Molecular weight | 213.56 g/mol |
| IUPAC name | 3-chloro-2-fluoro-6-(trifluoromethyl)aniline |
| InChIKey | ZHDSWEWAMCTWAZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1C(F)(F)F)N)F)Cl |
Computed by PubChem (NCBI)