Products 914225-61-9
CAS 914225-61-9 is the registry number for 3-Chloro-4-fluoro-5-(trifluoromethyl)aniline, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
3-chloro-4-fluoro-5-(trifluoromethyl)aniline (CAS 914225-61-9) is a chemical compound with the molecular formula C7H4ClF4N and a molecular weight of 213.56 g/mol. IUPAC name: 3-chloro-4-fluoro-5-(trifluoromethyl)aniline. InChIKey: KAHNTLCBWGVHDY-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF4N |
|---|---|
| Molecular weight | 213.56 g/mol |
| IUPAC name | 3-chloro-4-fluoro-5-(trifluoromethyl)aniline |
| InChIKey | KAHNTLCBWGVHDY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(F)(F)F)F)Cl)N |
Computed by PubChem (NCBI)