CAS 1805524-30-4 is the registry number for 2-Chloro-5-fluoro-4-(trifluoromethyl)aniline, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 1g.
2-chloro-5-fluoro-4-(trifluoromethyl)aniline (CAS 1805524-30-4) is a chemical compound with the molecular formula C7H4ClF4N and a molecular weight of 213.56 g/mol. IUPAC name: 2-chloro-5-fluoro-4-(trifluoromethyl)aniline. InChIKey: HQCISOOHPIHPGW-UHFFFAOYSA-N.
| Molecular formula | C7H4ClF4N |
|---|---|
| Molecular weight | 213.56 g/mol |
| IUPAC name | 2-chloro-5-fluoro-4-(trifluoromethyl)aniline |
| InChIKey | HQCISOOHPIHPGW-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)N)F)C(F)(F)F |
Computed by PubChem (NCBI)