Products 1092550-36-1
CAS 1092550-36-1 is the registry number for VU0240382. Offered by: MedChemExpress. Available pack sizes: Get quote.
6-(2-phenylethynyl)-3,4-dihydro-2H-isoquinolin-1-one (CAS 1092550-36-1) is a chemical compound with the molecular formula C17H13NO and a molecular weight of 247.29 g/mol. IUPAC name: 6-(2-phenylethynyl)-3,4-dihydro-2H-isoquinolin-1-one. InChIKey: BOVJHNHRQNCDEQ-UHFFFAOYSA-N.
| Molecular formula | C17H13NO |
|---|---|
| Molecular weight | 247.29 g/mol |
| IUPAC name | 6-(2-phenylethynyl)-3,4-dihydro-2H-isoquinolin-1-one |
| InChIKey | BOVJHNHRQNCDEQ-UHFFFAOYSA-N |
| SMILES | C1CNC(=O)C2=C1C=C(C=C2)C#CC3=CC=CC=C3 |
Computed by PubChem (NCBI)