CAS 1092689-34-3 is the registry number for 5-Norbornene-2-endo-acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid (CAS 1092689-34-3) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. IUPAC name: 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid. InChIKey: HRVGJQMCNYJEHM-CSMHCCOUSA-N.
| Molecular formula | C9H12O2 |
|---|---|
| Molecular weight | 152.19 g/mol |
| IUPAC name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid |
| InChIKey | HRVGJQMCNYJEHM-CSMHCCOUSA-N |
| SMILES | C1[C@@H]2C[C@H]([C@H]1C=C2)CC(=O)O |
Computed by PubChem (NCBI)