CAS 14734-13-5 is the registry number for rel-2-((1S,2S,4S)-Bicyclo(2.2.1)hept-5-en-2-yl)acetic acid, 98+%. Offered by: AmBeed. Available pack sizes: 1g.
2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid (CAS 14734-13-5) is a chemical compound with the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. IUPAC name: 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid. InChIKey: HRVGJQMCNYJEHM-CSMHCCOUSA-N.
| Molecular formula | C9H12O2 |
|---|---|
| Molecular weight | 152.19 g/mol |
| IUPAC name | 2-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]acetic acid |
| InChIKey | HRVGJQMCNYJEHM-CSMHCCOUSA-N |
| SMILES | C1[C@@H]2C[C@H]([C@H]1C=C2)CC(=O)O |
Computed by PubChem (NCBI)