CAS 1092841-04-7 is the registry number for 1-((4-Bromo-2-fluorophenoxy)methyl)-2,3-difluorobenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
1-[(4-bromo-2-fluorophenoxy)methyl]-2,3-difluorobenzene (CAS 1092841-04-7) is a chemical compound with the molecular formula C13H8BrF3O and a molecular weight of 317.10 g/mol. IUPAC name: 1-[(4-bromo-2-fluorophenoxy)methyl]-2,3-difluorobenzene. InChIKey: UKBDRFPUJFFGHW-UHFFFAOYSA-N.
| Molecular formula | C13H8BrF3O |
|---|---|
| Molecular weight | 317.10 g/mol |
| IUPAC name | 1-[(4-bromo-2-fluorophenoxy)methyl]-2,3-difluorobenzene |
| InChIKey | UKBDRFPUJFFGHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)COC2=C(C=C(C=C2)Br)F |
Computed by PubChem (NCBI)