CAS 54846-20-7 appears in our catalog under these names: 1-Bromo-4-phenoxy-2-(trifluoromethyl)benzene, 95%, 1-Bromo-4-phenoxy-2-(trifluoromethyl)benzene, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
1-bromo-4-phenoxy-2-(trifluoromethyl)benzene (CAS 54846-20-7) is a chemical compound with the molecular formula C13H8BrF3O and a molecular weight of 317.10 g/mol. IUPAC name: 1-bromo-4-phenoxy-2-(trifluoromethyl)benzene. InChIKey: AEDQRHJEKAYBDR-UHFFFAOYSA-N.
| Molecular formula | C13H8BrF3O |
|---|---|
| Molecular weight | 317.10 g/mol |
| IUPAC name | 1-bromo-4-phenoxy-2-(trifluoromethyl)benzene |
| InChIKey | AEDQRHJEKAYBDR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OC2=CC(=C(C=C2)Br)C(F)(F)F |
Computed by PubChem (NCBI)