Products 2794127-16-3
CAS 2794127-16-3 is the registry number for (6-bromo-2,3,4-trifluorophenyl)(phenyl)methanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(6-bromo-2,3,4-trifluorophenyl)-phenylmethanol (CAS 2794127-16-3) is a chemical compound with the molecular formula C13H8BrF3O and a molecular weight of 317.10 g/mol. IUPAC name: (6-bromo-2,3,4-trifluorophenyl)-phenylmethanol. InChIKey: IYYKOMIEDSQBRO-UHFFFAOYSA-N.
| Molecular formula | C13H8BrF3O |
|---|---|
| Molecular weight | 317.10 g/mol |
| IUPAC name | (6-bromo-2,3,4-trifluorophenyl)-phenylmethanol |
| InChIKey | IYYKOMIEDSQBRO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=C(C=C(C(=C2F)F)F)Br)O |
Computed by PubChem (NCBI)