CAS 1092935-76-6 is the registry number for 2-Deoxy-2-((7-nitro-2,1,3-benzoxadiazol-4-yl)amino)-L-glucose. Offered by: Biosynth. Available pack sizes: 2mg, 1mg.
3,4,5,6-tetrahydroxy-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanal (CAS 1092935-76-6) is a chemical compound with the molecular formula C12H14N4O8 and a molecular weight of 342.26 g/mol. IUPAC name: 3,4,5,6-tetrahydroxy-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanal. InChIKey: QUTFFEUUGHUPQC-UHFFFAOYSA-N.
| Molecular formula | C12H14N4O8 |
|---|---|
| Molecular weight | 342.26 g/mol |
| IUPAC name | 3,4,5,6-tetrahydroxy-2-[(4-nitro-2,1,3-benzoxadiazol-7-yl)amino]hexanal |
| InChIKey | QUTFFEUUGHUPQC-UHFFFAOYSA-N |
| SMILES | C1=C(C2=NON=C2C(=C1)[N+](=O)[O-])NC(C=O)C(C(C(CO)O)O)O |
Computed by PubChem (NCBI)