Products 1092952-64-1
CAS 1092952-64-1 is the registry number for Angelol M. Offered by: Biosynth, MedChemExpress. Available pack sizes: 10mg, 25mg, 50mg, Get quote.
[(1S,2S)-1,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutan-2-yl] (Z)-2-methylbut-2-enoate (CAS 1092952-64-1) is a chemical compound with the molecular formula C20H24O7 and a molecular weight of 376.4 g/mol. IUPAC name: [(1S,2S)-1,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutan-2-yl] (Z)-2-methylbut-2-enoate. InChIKey: GFMYIOGFYYHKLA-MKWBBVNXSA-N.
| Molecular formula | C20H24O7 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | [(1S,2S)-1,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutan-2-yl] (Z)-2-methylbut-2-enoate |
| InChIKey | GFMYIOGFYYHKLA-MKWBBVNXSA-N |
| SMILES | C/C=C(/C)\C(=O)O[C@@H]([C@H](C1=C(C=C2C(=C1)C=CC(=O)O2)OC)O)C(C)(C)O |
Computed by PubChem (NCBI)
Synonyms:
Angelol M, orb1683157