Products 83156-04-1
CAS 83156-04-1 appears in our catalog under these names: Angelol B, AngelolB, ≥98%. Offered by: MedChemExpress, Chemat. Available pack sizes: Get quote, 10mg.
[(1R,2S)-1,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutan-2-yl] (E)-2-methylbut-2-enoate (CAS 83156-04-1) is a chemical compound with the molecular formula C20H24O7 and a molecular weight of 376.4 g/mol. IUPAC name: [(1R,2S)-1,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutan-2-yl] (E)-2-methylbut-2-enoate. InChIKey: GFMYIOGFYYHKLA-ZRKIHGRPSA-N.
| Molecular formula | C20H24O7 |
|---|---|
| Molecular weight | 376.4 g/mol |
| IUPAC name | [(1R,2S)-1,3-dihydroxy-1-(7-methoxy-2-oxochromen-6-yl)-3-methylbutan-2-yl] (E)-2-methylbut-2-enoate |
| InChIKey | GFMYIOGFYYHKLA-ZRKIHGRPSA-N |
| SMILES | C/C=C(\C)/C(=O)O[C@@H]([C@@H](C1=C(C=C2C(=C1)C=CC(=O)O2)OC)O)C(C)(C)O |
Computed by PubChem (NCBI)
Synonyms:
angelol B, orb1684767