CAS 1093211-85-8 is the registry number for 1-[(2,2-Difluoro-1,3-benzodioxol-5-yl)methyl]piperazine, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]piperazine (CAS 1093211-85-8) is a chemical compound with the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. IUPAC name: 1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]piperazine. InChIKey: MPZINTHEMFDGTH-UHFFFAOYSA-N.
| Molecular formula | C12H14F2N2O2 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 1-[(2,2-difluoro-1,3-benzodioxol-5-yl)methyl]piperazine |
| InChIKey | MPZINTHEMFDGTH-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)CC2=CC3=C(C=C2)OC(O3)(F)F |
Computed by PubChem (NCBI)