Products 1273880-11-7
CAS 1273880-11-7 is the registry number for N-Cyclohexyl-2,3-difluoro-6-nitroaniline, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
N-cyclohexyl-2,3-difluoro-6-nitroaniline (CAS 1273880-11-7) is a chemical compound with the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. IUPAC name: N-cyclohexyl-2,3-difluoro-6-nitroaniline. InChIKey: HINZQJXKAHLSIT-UHFFFAOYSA-N.
| Molecular formula | C12H14F2N2O2 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | N-cyclohexyl-2,3-difluoro-6-nitroaniline |
| InChIKey | HINZQJXKAHLSIT-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)NC2=C(C=CC(=C2F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)