CAS 1430223-87-2 is the registry number for 2,5-Difluoro-4-(4-methylpiperazin-1-yl)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2,5-difluoro-4-(4-methylpiperazin-1-yl)benzoic acid (CAS 1430223-87-2) is a chemical compound with the molecular formula C12H14F2N2O2 and a molecular weight of 256.25 g/mol. IUPAC name: 2,5-difluoro-4-(4-methylpiperazin-1-yl)benzoic acid. InChIKey: MCXJPRWCYDMQEC-UHFFFAOYSA-N.
| Molecular formula | C12H14F2N2O2 |
|---|---|
| Molecular weight | 256.25 g/mol |
| IUPAC name | 2,5-difluoro-4-(4-methylpiperazin-1-yl)benzoic acid |
| InChIKey | MCXJPRWCYDMQEC-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=C(C=C(C(=C2)F)C(=O)O)F |
Computed by PubChem (NCBI)