Products 1093296-24-2
CAS 1093296-24-2 is the registry number for 5-Methoxy-6-methyl-3,4-dihydronaphthalen-1(2H)-one, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5-methoxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one (CAS 1093296-24-2) is a chemical compound with the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. IUPAC name: 5-methoxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one. InChIKey: CQLWUNVCKQNQAD-UHFFFAOYSA-N.
| Molecular formula | C12H14O2 |
|---|---|
| Molecular weight | 190.24 g/mol |
| IUPAC name | 5-methoxy-6-methyl-3,4-dihydro-2H-naphthalen-1-one |
| InChIKey | CQLWUNVCKQNQAD-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=C(C=C1)C(=O)CCC2)OC |
Computed by PubChem (NCBI)