Products 21492-28-4
CAS 21492-28-4 is the registry number for N-(3,4-dichlorophenyl)(4-methylpiperazinyl)formamide. Offered by: Biosynth. Available pack sizes: 250mg.
N-(3,4-dichlorophenyl)-4-methylpiperazine-1-carboxamide (CAS 21492-28-4) is a chemical compound with the molecular formula C12H15Cl2N3O and a molecular weight of 288.17 g/mol. IUPAC name: N-(3,4-dichlorophenyl)-4-methylpiperazine-1-carboxamide. InChIKey: MHGBNKILXYHXGE-UHFFFAOYSA-N.
| Molecular formula | C12H15Cl2N3O |
|---|---|
| Molecular weight | 288.17 g/mol |
| IUPAC name | N-(3,4-dichlorophenyl)-4-methylpiperazine-1-carboxamide |
| InChIKey | MHGBNKILXYHXGE-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C(=O)NC2=CC(=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)