Products 1093415-88-3
CAS 1093415-88-3 is the registry number for 5-(2-Isobutyl)-4-amino-1H-pyrazole-3-carboxylic Acid. Offered by: TRC. Available pack sizes: 100mg, 250mg, 50mg.
4-amino-5-(2-methylpropyl)-1H-pyrazole-3-carboxylic acid (CAS 1093415-88-3) is a chemical compound with the molecular formula C8H13N3O2 and a molecular weight of 183.21 g/mol. IUPAC name: 4-amino-5-(2-methylpropyl)-1H-pyrazole-3-carboxylic acid. InChIKey: LCZNVFNEAVOWDQ-UHFFFAOYSA-N.
| Molecular formula | C8H13N3O2 |
|---|---|
| Molecular weight | 183.21 g/mol |
| IUPAC name | 4-amino-5-(2-methylpropyl)-1H-pyrazole-3-carboxylic acid |
| InChIKey | LCZNVFNEAVOWDQ-UHFFFAOYSA-N |
| SMILES | CC(C)CC1=C(C(=NN1)C(=O)O)N |
Computed by PubChem (NCBI)