CAS 109376-35-4 appears in our catalog under these names: (Carbethoxymethyl-1,2-13C2)triphenylphosphonium bromide, 98% 98%atom%13C, (Ethoxycarbonylmethyl)triphenylphosphonium-13C2 Bromide. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 500mg.
(2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide (CAS 109376-35-4) is a chemical compound with the molecular formula C22H22BrO2P and a molecular weight of 431.3 g/mol. IUPAC name: (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide. InChIKey: VJVZPTPOYCJFNI-WWPGYFPTSA-M.
| Molecular formula | C22H22BrO2P |
|---|---|
| Molecular weight | 431.3 g/mol |
| IUPAC name | (2-ethoxy-2-oxo(1,2-13C2)ethyl)-triphenylphosphanium bromide |
| InChIKey | VJVZPTPOYCJFNI-WWPGYFPTSA-M |
| SMILES | CCO[13C](=O)[13CH2][P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)