CAS 1530-45-6 appears in our catalog under these names: (Ethoxycarbonylmethyl)triphenylphosphonium Bromide, Ethoxycarbonylmethyl(triphenyl)phosphonium Bromide, (Ethoxycarbonylmethyl)triphenylphosphonium bromide, 98+% , Ethoxycarbonylmethyl(triphenyl)phosphonium Bromide, >97.0%(T), (Carbethoxymethyl)triphenylphosphonium bromide, 98%. Offered by: TRC, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Thermo Scientific (Acros). Available pack sizes: 100mg, 25mg, 50mg, 100g, 500g, 25g, 250g, 10g.
(2-ethoxy-2-oxoethyl)-triphenylphosphanium bromide (CAS 1530-45-6) is a chemical compound with the molecular formula C22H22BrO2P and a molecular weight of 429.3 g/mol. IUPAC name: (2-ethoxy-2-oxoethyl)-triphenylphosphanium bromide. InChIKey: VJVZPTPOYCJFNI-UHFFFAOYSA-M.
| Molecular formula | C22H22BrO2P |
|---|---|
| Molecular weight | 429.3 g/mol |
| IUPAC name | (2-ethoxy-2-oxoethyl)-triphenylphosphanium bromide |
| InChIKey | VJVZPTPOYCJFNI-UHFFFAOYSA-M |
| SMILES | CCOC(=O)C[P+](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3.[Br-] |
Computed by PubChem (NCBI)