CAS 52509-14-5 appears in our catalog under these names: (1,3-Dioxolan-2-ylmethyl)triphenylphosphonium Bromide, (1,3-Dioxolan-2-ylmethyl)triphenylphosphonium bromide, 98% , (1,3-Dioxolan-2-yl)methyltriphenylphosphonium Bromide, (1,3-Dioxolan-2-yl)methyltriphenylphosphonium Bromide, >97.0%(T), ((1,3-Dioxolan-2-yl)methyl)triphenylphosphonium bromide 97%. Offered by: TRC, Thermo Scientific (Alfa Aesar), Biosynth, TCI, Ambeed. Available pack sizes: 10g, 25g, 5g, 50g, 250g, 0,25kg, 0,1kg, 0,5kg.
1,3-dioxolan-2-ylmethyl(triphenyl)phosphanium bromide (CAS 52509-14-5) is a chemical compound with the molecular formula C22H22BrO2P and a molecular weight of 429.3 g/mol. IUPAC name: 1,3-dioxolan-2-ylmethyl(triphenyl)phosphanium bromide. InChIKey: FRHRVQQUICVJDG-UHFFFAOYSA-M.
| Molecular formula | C22H22BrO2P |
|---|---|
| Molecular weight | 429.3 g/mol |
| IUPAC name | 1,3-dioxolan-2-ylmethyl(triphenyl)phosphanium bromide |
| InChIKey | FRHRVQQUICVJDG-UHFFFAOYSA-M |
| SMILES | C1COC(O1)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)