Products 1094106-61-2
CAS 1094106-61-2 appears in our catalog under these names: N–(4–chloro–3–fluorophenyl)–2，2，2–trifluoroacetamide, N-(4-Chloro-3-fluorophenyl)-2,2,2-trifluoroacetamide, 98%. Offered by: GLPBio, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
N-(4-chloro-3-fluorophenyl)-2,2,2-trifluoroacetamide (CAS 1094106-61-2) is a chemical compound with the molecular formula C8H4ClF4NO and a molecular weight of 241.57 g/mol. IUPAC name: N-(4-chloro-3-fluorophenyl)-2,2,2-trifluoroacetamide. InChIKey: YMGGSGUQDWLEOT-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF4NO |
|---|---|
| Molecular weight | 241.57 g/mol |
| IUPAC name | N-(4-chloro-3-fluorophenyl)-2,2,2-trifluoroacetamide |
| InChIKey | YMGGSGUQDWLEOT-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)C(F)(F)F)F)Cl |
Computed by PubChem (NCBI)