CAS 129931-46-0 appears in our catalog under these names: 3-Chloro-2-fluoro-5-(trifluoromethyl)benzamide, 95%, 3-Chloro-2-fluoro-5-(trifluoromethyl)benzamide. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 1g.
3-chloro-2-fluoro-5-(trifluoromethyl)benzamide (CAS 129931-46-0) is a chemical compound with the molecular formula C8H4ClF4NO and a molecular weight of 241.57 g/mol. IUPAC name: 3-chloro-2-fluoro-5-(trifluoromethyl)benzamide. InChIKey: ITROXMKOCKYPDM-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF4NO |
|---|---|
| Molecular weight | 241.57 g/mol |
| IUPAC name | 3-chloro-2-fluoro-5-(trifluoromethyl)benzamide |
| InChIKey | ITROXMKOCKYPDM-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C(=O)N)F)Cl)C(F)(F)F |
Computed by PubChem (NCBI)