CAS 832675-11-3 is the registry number for 2-Chloro-N-(2,3,5,6-tetrafluorophenyl)acetamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-N-(2,3,5,6-tetrafluorophenyl)acetamide (CAS 832675-11-3) is a chemical compound with the molecular formula C8H4ClF4NO and a molecular weight of 241.57 g/mol. IUPAC name: 2-chloro-N-(2,3,5,6-tetrafluorophenyl)acetamide. InChIKey: LGNJOSKDYPMJOK-UHFFFAOYSA-N.
| Molecular formula | C8H4ClF4NO |
|---|---|
| Molecular weight | 241.57 g/mol |
| IUPAC name | 2-chloro-N-(2,3,5,6-tetrafluorophenyl)acetamide |
| InChIKey | LGNJOSKDYPMJOK-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(C(=C1F)F)NC(=O)CCl)F)F |
Computed by PubChem (NCBI)