Products 1094225-67-8
CAS 1094225-67-8 is the registry number for (7-Bromo-1,3-dioxaindan-5-yl)methanamine. Offered by: Biosynth. Available pack sizes: 1000mg, 5000mg, 10000mg.
(7-bromo-1,3-benzodioxol-5-yl)methanamine (CAS 1094225-67-8) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: (7-bromo-1,3-benzodioxol-5-yl)methanamine. InChIKey: ZIQQORINAWIECM-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | (7-bromo-1,3-benzodioxol-5-yl)methanamine |
| InChIKey | ZIQQORINAWIECM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C(=CC(=C2)CN)Br |
Computed by PubChem (NCBI)