CAS 1094231-73-8 is the registry number for 5-(4-Methanesulfonylphenyl)-1,2,4-triazin-3-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
5-(4-methylsulfonylphenyl)-1,2,4-triazin-3-amine (CAS 1094231-73-8) is a chemical compound with the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. IUPAC name: 5-(4-methylsulfonylphenyl)-1,2,4-triazin-3-amine. InChIKey: UUINYHCZXYMAEI-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | 5-(4-methylsulfonylphenyl)-1,2,4-triazin-3-amine |
| InChIKey | UUINYHCZXYMAEI-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)C2=CN=NC(=N2)N |
Computed by PubChem (NCBI)