CAS 114402-22-1 appears in our catalog under these names: 2-((4-Amino-5-phenyl-4H-1,2,4-triazol-3-yl)thio)acetic acid, 95+%, 2-((4-Amino-5-phenyl-4H-1,2,4-triazol-3-yl)sulfanyl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid (CAS 114402-22-1) is a chemical compound with the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. IUPAC name: 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid. InChIKey: MXKJHOYDQUYSEW-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]acetic acid |
| InChIKey | MXKJHOYDQUYSEW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NN=C(N2N)SCC(=O)O |
Computed by PubChem (NCBI)