CAS 29527-36-4 appears in our catalog under these names: 4-Ethyl-5-(4-nitrophenyl)-4H-1,2,4-triazole-3-thiol, 4-Ethyl-5-(4-nitrophenyl)-4h-1,2,4-triazole-3-thiol, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 1g.
4-ethyl-3-(4-nitrophenyl)-1H-1,2,4-triazole-5-thione (CAS 29527-36-4) is a chemical compound with the molecular formula C10H10N4O2S and a molecular weight of 250.28 g/mol. IUPAC name: 4-ethyl-3-(4-nitrophenyl)-1H-1,2,4-triazole-5-thione. InChIKey: JNZXGFSUVHHLKG-UHFFFAOYSA-N.
| Molecular formula | C10H10N4O2S |
|---|---|
| Molecular weight | 250.28 g/mol |
| IUPAC name | 4-ethyl-3-(4-nitrophenyl)-1H-1,2,4-triazole-5-thione |
| InChIKey | JNZXGFSUVHHLKG-UHFFFAOYSA-N |
| SMILES | CCN1C(=NNC1=S)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)