Products 1094255-98-7
CAS 1094255-98-7 is the registry number for 3-[(4-Bromophenyl)methyl]-5-(chloromethyl)-1,2,4-oxadiazole, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 5g.
3-[(4-bromophenyl)methyl]-5-(chloromethyl)-1,2,4-oxadiazole (CAS 1094255-98-7) is a chemical compound with the molecular formula C10H8BrClN2O and a molecular weight of 287.54 g/mol. IUPAC name: 3-[(4-bromophenyl)methyl]-5-(chloromethyl)-1,2,4-oxadiazole. InChIKey: PTQMLDMLSLOTEH-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClN2O |
|---|---|
| Molecular weight | 287.54 g/mol |
| IUPAC name | 3-[(4-bromophenyl)methyl]-5-(chloromethyl)-1,2,4-oxadiazole |
| InChIKey | PTQMLDMLSLOTEH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CC2=NOC(=N2)CCl)Br |
Computed by PubChem (NCBI)