Products 2275753-30-3
CAS 2275753-30-3 is the registry number for 7-Bromo-9-chloro-2-ethyl-4H-pyrido[1,2-a]pyrimidin-4-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-bromo-9-chloro-2-ethylpyrido[1,2-a]pyrimidin-4-one (CAS 2275753-30-3) is a chemical compound with the molecular formula C10H8BrClN2O and a molecular weight of 287.54 g/mol. IUPAC name: 7-bromo-9-chloro-2-ethylpyrido[1,2-a]pyrimidin-4-one. InChIKey: ODJXWBBHOJPBMU-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClN2O |
|---|---|
| Molecular weight | 287.54 g/mol |
| IUPAC name | 7-bromo-9-chloro-2-ethylpyrido[1,2-a]pyrimidin-4-one |
| InChIKey | ODJXWBBHOJPBMU-UHFFFAOYSA-N |
| SMILES | CCC1=CC(=O)N2C=C(C=C(C2=N1)Cl)Br |
Computed by PubChem (NCBI)