Products 2065250-12-4
CAS 2065250-12-4 appears in our catalog under these names: 8-Bromo-7-chloro-2-methoxy-3-methyl-[1,5]naphthyridine, 95%, 8-Bromo-7-chloro-2-methoxy-3-methyl-1,5-naphthyridine, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg.
8-bromo-7-chloro-2-methoxy-3-methyl-1,5-naphthyridine (CAS 2065250-12-4) is a chemical compound with the molecular formula C10H8BrClN2O and a molecular weight of 287.54 g/mol. IUPAC name: 8-bromo-7-chloro-2-methoxy-3-methyl-1,5-naphthyridine. InChIKey: VSFYVHOMBLLDDR-UHFFFAOYSA-N.
| Molecular formula | C10H8BrClN2O |
|---|---|
| Molecular weight | 287.54 g/mol |
| IUPAC name | 8-bromo-7-chloro-2-methoxy-3-methyl-1,5-naphthyridine |
| InChIKey | VSFYVHOMBLLDDR-UHFFFAOYSA-N |
| SMILES | CC1=CC2=NC=C(C(=C2N=C1OC)Br)Cl |
Computed by PubChem (NCBI)