Products 1094260-24-8
CAS 1094260-24-8 appears in our catalog under these names: 6-Chloro-3-cyclopentyl-[1,2,4]triazolo[4,3-b]pyridazine, 95%, 6-Chloro-3-cyclopentyl-(1,2,4)triazolo(4,3-b)pyridazine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
6-chloro-3-cyclopentyl-[1,2,4]triazolo[4,3-b]pyridazine (CAS 1094260-24-8) is a chemical compound with the molecular formula C10H11ClN4 and a molecular weight of 222.67 g/mol. IUPAC name: 6-chloro-3-cyclopentyl-[1,2,4]triazolo[4,3-b]pyridazine. InChIKey: XWTSXPYGTBZXFK-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 6-chloro-3-cyclopentyl-[1,2,4]triazolo[4,3-b]pyridazine |
| InChIKey | XWTSXPYGTBZXFK-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)C2=NN=C3N2N=C(C=C3)Cl |
Computed by PubChem (NCBI)