CAS 2098078-31-8 is the registry number for 3-Azido-1-(3-chlorobenzyl)azetidine. Offered by: TRC. Available pack sizes: 2,5g.
3-azido-1-[(3-chlorophenyl)methyl]azetidine (CAS 2098078-31-8) is a chemical compound with the molecular formula C10H11ClN4 and a molecular weight of 222.67 g/mol. IUPAC name: 3-azido-1-[(3-chlorophenyl)methyl]azetidine. InChIKey: PHLNOEYQYKKURU-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 3-azido-1-[(3-chlorophenyl)methyl]azetidine |
| InChIKey | PHLNOEYQYKKURU-UHFFFAOYSA-N |
| SMILES | C1C(CN1CC2=CC(=CC=C2)Cl)N=[N+]=[N-] |
Computed by PubChem (NCBI)