CAS 73963-34-5 appears in our catalog under these names: 5-(3-Chloropropyl)-1-Phenyl-1H-1,2,3,4-Tetrazole, 5-(3-Chloropropyl)-1-phenyl-1H-1,2,3,4-tetrazole, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg, 25mg, 50mg.
5-(3-chloropropyl)-1-phenyltetrazole (CAS 73963-34-5) is a chemical compound with the molecular formula C10H11ClN4 and a molecular weight of 222.67 g/mol. IUPAC name: 5-(3-chloropropyl)-1-phenyltetrazole. InChIKey: DALGHUJUPOTHSH-UHFFFAOYSA-N.
| Molecular formula | C10H11ClN4 |
|---|---|
| Molecular weight | 222.67 g/mol |
| IUPAC name | 5-(3-chloropropyl)-1-phenyltetrazole |
| InChIKey | DALGHUJUPOTHSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)N2C(=NN=N2)CCCCl |
Computed by PubChem (NCBI)