CAS 1094293-78-3 appears in our catalog under these names: 2-(2-(4-Bromothiophen-2-yl)-1,3-thiazol-4-yl)acetic acid, 95%, 2-(2-(4-Bromothiophen-2-yl)-1,3-thiazol-4-yl)acetic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetic acid (CAS 1094293-78-3) is a chemical compound with the molecular formula C9H6BrNO2S2 and a molecular weight of 304.2 g/mol. IUPAC name: 2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetic acid. InChIKey: DIWICFWGJWBALI-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2S2 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | DIWICFWGJWBALI-UHFFFAOYSA-N |
| SMILES | C1=C(SC=C1Br)C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)