CAS 1550010-55-3 is the registry number for Methyl 2-(5-bromothiophen-2-yl)thiazole-4-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 2-(5-bromothiophen-2-yl)-1,3-thiazole-4-carboxylate (CAS 1550010-55-3) is a chemical compound with the molecular formula C9H6BrNO2S2 and a molecular weight of 304.2 g/mol. IUPAC name: methyl 2-(5-bromothiophen-2-yl)-1,3-thiazole-4-carboxylate. InChIKey: SIBXNGYDOQLPCY-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2S2 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | methyl 2-(5-bromothiophen-2-yl)-1,3-thiazole-4-carboxylate |
| InChIKey | SIBXNGYDOQLPCY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CSC(=N1)C2=CC=C(S2)Br |
Computed by PubChem (NCBI)