CAS 1548344-96-2 is the registry number for 2-(2-(3-Bromothiophen-2-yl)thiazol-4-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-[2-(3-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetic acid (CAS 1548344-96-2) is a chemical compound with the molecular formula C9H6BrNO2S2 and a molecular weight of 304.2 g/mol. IUPAC name: 2-[2-(3-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetic acid. InChIKey: OPAUDDNBDDMLCA-UHFFFAOYSA-N.
| Molecular formula | C9H6BrNO2S2 |
|---|---|
| Molecular weight | 304.2 g/mol |
| IUPAC name | 2-[2-(3-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetic acid |
| InChIKey | OPAUDDNBDDMLCA-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1Br)C2=NC(=CS2)CC(=O)O |
Computed by PubChem (NCBI)