Products 1548344-96-2

CAS 1548344-96-2 is the registry number for 2-(2-(3-Bromothiophen-2-yl)thiazol-4-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

2-[2-(3-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetic acid (CAS 1548344-96-2) is a chemical compound with the molecular formula C9H6BrNO2S2 and a molecular weight of 304.2 g/mol. IUPAC name: 2-[2-(3-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetic acid. InChIKey: OPAUDDNBDDMLCA-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6BrNO2S2
Molecular weight304.2 g/mol
IUPAC name2-[2-(3-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetic acid
InChIKeyOPAUDDNBDDMLCA-UHFFFAOYSA-N
SMILESC1=CSC(=C1Br)C2=NC(=CS2)CC(=O)O

Computed by PubChem (NCBI)