CAS 1094311-98-4 appears in our catalog under these names: (2,4-Difluorophenyl)(2-fluorophenyl)methanone, 95%, (2,4-Difluorophenyl)(2-fluorophenyl)methanone. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 100mg, 1g.
(2,4-difluorophenyl)-(2-fluorophenyl)methanone (CAS 1094311-98-4) is a chemical compound with the molecular formula C13H7F3O and a molecular weight of 236.19 g/mol. IUPAC name: (2,4-difluorophenyl)-(2-fluorophenyl)methanone. InChIKey: YLCVDBUSGAJCHM-UHFFFAOYSA-N.
| Molecular formula | C13H7F3O |
|---|---|
| Molecular weight | 236.19 g/mol |
| IUPAC name | (2,4-difluorophenyl)-(2-fluorophenyl)methanone |
| InChIKey | YLCVDBUSGAJCHM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=C(C=C(C=C2)F)F)F |
Computed by PubChem (NCBI)