Products 951885-79-3
CAS 951885-79-3 is the registry number for (3,5-Difluorophenyl)(3-fluorophenyl)methanone, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
(3,5-difluorophenyl)-(3-fluorophenyl)methanone (CAS 951885-79-3) is a chemical compound with the molecular formula C13H7F3O and a molecular weight of 236.19 g/mol. IUPAC name: (3,5-difluorophenyl)-(3-fluorophenyl)methanone. InChIKey: VEBBXLANVYEQCR-UHFFFAOYSA-N.
| Molecular formula | C13H7F3O |
|---|---|
| Molecular weight | 236.19 g/mol |
| IUPAC name | (3,5-difluorophenyl)-(3-fluorophenyl)methanone |
| InChIKey | VEBBXLANVYEQCR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)F)C(=O)C2=CC(=CC(=C2)F)F |
Computed by PubChem (NCBI)