CAS 70028-88-5 appears in our catalog under these names: 3,4,5-Trifluorobenzophenone, 97%, 3,4,5–Trifluorobenzophenone, Phenyl(3,4,5-trifluorophenyl)methanone 98%, Phenyl(3,4,5-trifluorophenyl)methanone, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g.
Phenyl-(3,4,5-trifluorophenyl)methanone (CAS 70028-88-5) is a chemical compound with the molecular formula C13H7F3O and a molecular weight of 236.19 g/mol. IUPAC name: phenyl-(3,4,5-trifluorophenyl)methanone. InChIKey: BTQOMZVQASIULU-UHFFFAOYSA-N.
| Molecular formula | C13H7F3O |
|---|---|
| Molecular weight | 236.19 g/mol |
| IUPAC name | phenyl-(3,4,5-trifluorophenyl)methanone |
| InChIKey | BTQOMZVQASIULU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC(=C(C(=C2)F)F)F |
Computed by PubChem (NCBI)