CAS 1094315-38-4 appears in our catalog under these names: 4-Methyl-2-phenylpiperazine-1-sulfonamide, 4-Methyl-2-phenylpiperazine-1-sulfonamide, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 250mg, 2,5g, 5g.
4-methyl-2-phenylpiperazine-1-sulfonamide (CAS 1094315-38-4) is a chemical compound with the molecular formula C11H17N3O2S and a molecular weight of 255.34 g/mol. IUPAC name: 4-methyl-2-phenylpiperazine-1-sulfonamide. InChIKey: WPMACSYNVGRFNI-UHFFFAOYSA-N.
| Molecular formula | C11H17N3O2S |
|---|---|
| Molecular weight | 255.34 g/mol |
| IUPAC name | 4-methyl-2-phenylpiperazine-1-sulfonamide |
| InChIKey | WPMACSYNVGRFNI-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(C1)C2=CC=CC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)