CAS 1094333-70-6 is the registry number for 1-(2-Bromophenyl)-5-(chloromethyl)-1H-1,2,3,4-tetrazole. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
1-(2-bromophenyl)-5-(chloromethyl)tetrazole (CAS 1094333-70-6) is a chemical compound with the molecular formula C8H6BrClN4 and a molecular weight of 273.52 g/mol. IUPAC name: 1-(2-bromophenyl)-5-(chloromethyl)tetrazole. InChIKey: GARANGMNWQXXQG-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClN4 |
|---|---|
| Molecular weight | 273.52 g/mol |
| IUPAC name | 1-(2-bromophenyl)-5-(chloromethyl)tetrazole |
| InChIKey | GARANGMNWQXXQG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C(=NN=N2)CCl)Br |
Computed by PubChem (NCBI)