Products 1250758-60-1
CAS 1250758-60-1 is the registry number for 4-Bromo-1-(3-chloropyridin-2-yl)-1H-pyrazol-3-amine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-bromo-1-(3-chloro-2-pyridinyl)pyrazol-3-amine (CAS 1250758-60-1) is a chemical compound with the molecular formula C8H6BrClN4 and a molecular weight of 273.52 g/mol. IUPAC name: 4-bromo-1-(3-chloro-2-pyridinyl)pyrazol-3-amine. InChIKey: KQAORJZIMJKIFR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClN4 |
|---|---|
| Molecular weight | 273.52 g/mol |
| IUPAC name | 4-bromo-1-(3-chloro-2-pyridinyl)pyrazol-3-amine |
| InChIKey | KQAORJZIMJKIFR-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(N=C1)N2C=C(C(=N2)N)Br)Cl |
Computed by PubChem (NCBI)