CAS 1908455-60-6 is the registry number for 6-Bromo-2-chloro-5-methylpyrido[2,3-d]pyrimidin-7-amine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-bromo-2-chloro-5-methylpyrido[2,3-d]pyrimidin-7-amine (CAS 1908455-60-6) is a chemical compound with the molecular formula C8H6BrClN4 and a molecular weight of 273.52 g/mol. IUPAC name: 6-bromo-2-chloro-5-methylpyrido[2,3-d]pyrimidin-7-amine. InChIKey: KLYZERWPNSRHAR-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClN4 |
|---|---|
| Molecular weight | 273.52 g/mol |
| IUPAC name | 6-bromo-2-chloro-5-methylpyrido[2,3-d]pyrimidin-7-amine |
| InChIKey | KLYZERWPNSRHAR-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=NC2=NC(=NC=C12)Cl)N)Br |
Computed by PubChem (NCBI)