CAS 1094385-32-6 appears in our catalog under these names: 5-(4-Ethylphenyl)-1,2,4-triazin-3-amine, 95%, 5-(4-Ethylphenyl)-1,2,4-triazin-3-amine. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g.
5-(4-ethylphenyl)-1,2,4-triazin-3-amine (CAS 1094385-32-6) is a chemical compound with the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. IUPAC name: 5-(4-ethylphenyl)-1,2,4-triazin-3-amine. InChIKey: LUENLFADXCMHTC-UHFFFAOYSA-N.
| Molecular formula | C11H12N4 |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 5-(4-ethylphenyl)-1,2,4-triazin-3-amine |
| InChIKey | LUENLFADXCMHTC-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CN=NC(=N2)N |
Computed by PubChem (NCBI)