CAS 1240527-58-5 appears in our catalog under these names: 3-(3-Cyclopropyl-1h-1,2,4-triazol-5-yl)aniline, 95%, 3-(3-Cyclopropyl-1H-1,2,4-triazol-5-yl)aniline. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g, 0,5g.
3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)aniline (CAS 1240527-58-5) is a chemical compound with the molecular formula C11H12N4 and a molecular weight of 200.24 g/mol. IUPAC name: 3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)aniline. InChIKey: ODDGTCDQXORBSD-UHFFFAOYSA-N.
| Molecular formula | C11H12N4 |
|---|---|
| Molecular weight | 200.24 g/mol |
| IUPAC name | 3-(5-cyclopropyl-1H-1,2,4-triazol-3-yl)aniline |
| InChIKey | ODDGTCDQXORBSD-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC(=NN2)C3=CC(=CC=C3)N |
Computed by PubChem (NCBI)